Neokadsuranin
|
| Identifiers
|
|
|
|
|
|
|
| ChEMBL
|
|
| ChemSpider
|
|
|
|
|
InChI=1S/C23H26O7/c1-10-11(2)19-13-8-15-21(29-9-28-15)23(27-6)17(13)16-12(18(10)30-19)7-14(24-3)20(25-4)22(16)26-5/h7-8,10-11,18-19H,9H2,1-6H3/t10-,11+,18-,19+/m0/s1 Key: RNIZTMIJCBCDBR-XJSVZPCESA-N
|
C[C@@H]1[C@@H]([C@H]2C3=CC(=C(C(=C3C4=C(C5=C(C=C4[C@@H]1O2)OCO5)OC)OC)OC)OC)C
|
| Properties
|
|
|
C23H26O7
|
| Molar mass
|
414.454 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Chemical compound
Neokadsuranin is a chemical compound isolated from Kadsura induta that has in vitro antiviral effects.[1]
- ^ Ma, Wenhui; Ma, Xiaolin; Huang, Hai; Zhou, Pei; Chen, Daofeng (2007). "Dibenzocyclooctane Lignans from the Stems of Kadsura induta and Their Antiviral Effect on Hepatitis B Virus". Chemistry & Biodiversity. 4 (5): 966–972. doi:10.1002/cbdv.200790087. PMID 17511012. S2CID 12166640.
