Names | |
---|---|
Preferred IUPAC name
(6Z)-Octadec-6-enoic acid | |
Other names
(6Z)-Octadecenoic acid
(Z)-Octadec-6-enoic acid cis-6-Octadecenoic acid cis-Δ6-Octadecenoic acid Petroselinic acid 18:1 cis-6 | |
Identifiers | |
3D model (JSmol)
|
|
ChEBI | |
ChemSpider | |
ECHA InfoCard | 100.008.901 |
EC Number |
|
KEGG | |
PubChem CID
|
|
UNII | |
CompTox Dashboard (EPA)
|
|
| |
| |
Properties | |
C18H34O2 | |
Molar mass | 282.468 g·mol−1 |
Appearance | White powder |
Insoluble | |
Solubility in methanol | Soluble |
Hazards | |
GHS labelling:[1] | |
Warning | |
H315, H319, H335 | |
P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 | |
Safety data sheet (SDS) | MSDS from Sigma-Aldrich |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Petroselinic acid is a fatty acid that occurs naturally in several animal and vegetable fats and oils. It is a white powder and is commercially available.[2] In chemical terms, petroselinic acid is classified as a monounsaturated omega-12 fatty acid, abbreviated with a lipid number of 18:1 cis-6. It has the formula CH3(CH2)10CH=CH(CH2)4COOH. The term "petroselinic" means related to, or derived from, oil of Petroselinum, parsley. Despite its name, petroselinic acid does not contain any selenium. Petroselinic acid is a positional isomer of oleic acid.