Names | |
---|---|
Other names
Pigment Red 3, 1-(4-Methyl-2-nitrophenylazo)-2-naphthol
| |
Identifiers | |
3D model (JSmol)
|
|
ChEBI | |
ChEMBL | |
ChemSpider | |
ECHA InfoCard | 100.017.612 |
EC Number |
|
KEGG | |
PubChem CID
|
|
UNII | |
CompTox Dashboard (EPA)
|
|
| |
| |
Properties | |
C17H13N3O3 | |
Molar mass | 307.309 g·mol−1 |
Appearance | red solid |
Density | 1.434 g/cm3[1] |
Melting point | 269 °C |
low | |
Hazards | |
GHS labelling:[2] | |
Danger | |
H318, H410, H413 | |
P264+P265, P273, P280, P305+P354+P338, P317, P391, P501 | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Toluidine red is an organic compound with the formula C10H6(OH)(N2C6H3(NO2)CH3). A dark red solid, the compound is classified as a azo dye consisting of a 2-naphthol group linked to a 2-nitro-4-methylphenyl substituent.[3] Toluidine red is a traditional pigment, found in oil paints.[4] Although once popular, it suffers as a pigment owing to "insufficient lightfastness and bleeding when incorporated into a paint system."[1]