Names | |
---|---|
Preferred IUPAC name
(5E)-6,10-Dimethylundeca-5,9-dien-2-one | |
Other names
6,10-dimethyl-(5E)-5,9-undecadien-2-one, (E)-geranylacetone
| |
Identifiers | |
3D model (JSmol)
|
|
ChEBI | |
ChemSpider | |
ECHA InfoCard | 100.021.155 |
EC Number |
|
PubChem CID
|
|
UNII | |
CompTox Dashboard (EPA)
|
|
| |
| |
Properties | |
C13H22O | |
Molar mass | 194.318 g·mol−1 |
Density | 0.8698 g/cm3 (20 °C) |
Boiling point | 126–8 °C (259–46 °F; 399–281 K) 10 mm Hg |
Hazards | |
GHS labelling: | |
Warning | |
H315, H411 | |
P264, P273, P280, P302+P352, P321, P332+P313, P362, P391, P501 | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Geranylacetone is an organic compound with the formula CH3C(O)(CH2)2CH=C(CH3)(CH2)2CH=C(CH3)2. A colorless oil, it is the product of coupling geranyl and acetonyl groups. It is a precursor to synthetic squalene.[1]