Anxiolytic drug
ICI-190,622 |
|
ATC code | |
---|
|
4-Amino-1-pent-3-ynyl-N-prop-2-enylpyrazolo[3,4-b]pyridine-5-carboxamide
|
CAS Number | |
---|
PubChem CID | |
---|
ChemSpider | |
---|
UNII | |
---|
ChEMBL | |
---|
CompTox Dashboard (EPA) | |
---|
|
Formula | C15H17N5O |
---|
Molar mass | 283.335 g·mol−1 |
---|
3D model (JSmol) | |
---|
CC#CCCN1C2=NC=C(C(=C2C=N1)N)C(=O)NCC=C
|
InChI=1S/C15H17N5O/c1-3-5-6-8-20-14-11(10-19-20)13(16)12(9-18-14)15(21)17-7-4-2/h4,9-10H,2,6-8H2,1H3,(H2,16,18)(H,17,21) NKey:ZPOHUNITDKKDQD-UHFFFAOYSA-N N
|
NY (what is this?) (verify) |
ICI-190,622 is an anxiolytic drug used in scientific research. It is a pyrazolopyridine derivative, related to other anxiolytic compounds such as tracazolate, and more distantly to zaleplon. It has similar effects to benzodiazepine drugs, but is structurally distinct and so is classed as a nonbenzodiazepine anxiolytic.[1][2]
- ^
- ^ Bare TM, McLaren CD, Campbell JB, Firor JW, Resch JF, Walters CP, Salama AI, Meiners BA, Patel JB (December 1989). "Synthesis and structure-activity relationships of a series of anxioselective pyrazolopyridine ester and amide anxiolytic agents". Journal of Medicinal Chemistry. 32 (12): 2561–73. doi:10.1021/jm00132a011. PMID 2573731.